C23H35NO2Se — CID 139265173
(2S)-1-[[2-[(3S)-3,7-dimethylocta-1,6-dien-3-yl]oxyselanylphenyl]methyl]-2-(methoxymethyl)pyrrolidine (PubChem CID 139265173) has the molecular formula C23H35NO2Se and a molecular weight of 436.50 g/mol. Its IUPAC name is (2S)-1-[[2-[(3S)-3,7-dimethylocta-1,6-dien-3-yl]oxyselanylphenyl]methyl]-2-(methoxymethyl)pyrrolidine.
| Compound Name | (2S)-1-[[2-[(3S)-3,7-dimethylocta-1,6-dien-3-yl]oxyselanylphenyl]methyl]-2-(methoxymethyl)pyrrolidine |
|---|---|
| PubChem CID | 139265173 |
| Molecular Formula | C23H35NO2Se |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | (2S)-1-[[2-[(3S)-3,7-dimethylocta-1,6-dien-3-yl]oxyselanylphenyl]methyl]-2-(methoxymethyl)pyrrolidine |
| SMILES | C=C[C@](C)(CCC=C(C)C)O[Se]c1ccccc1CN1CCC[C@H]1COC |
| InChI | InChI=1S/C23H35NO2Se/c1-6-23(4,15-9-11-19(2)3)26-27-22-14-8-7-12-20(22)17-24-16-10-13-21(24)18-25-5/h6-8,11-12,14,21H,1,9-10,13,15-18H2,2-5H3/t21-,23+/m0/s1 |
| InChIKey | REFCQMSDHGIBLE-JTHBVZDNSA-N |
| XLogP | 4.25 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|