C9H14O4 — CID 139265982
methyl 2-[(2S,6S)-6-methyl-3-oxooxan-2-yl]acetate (PubChem CID 139265982) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is methyl 2-[(2S,6S)-6-methyl-3-oxooxan-2-yl]acetate.
| Compound Name | methyl 2-[(2S,6S)-6-methyl-3-oxooxan-2-yl]acetate |
|---|---|
| PubChem CID | 139265982 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | methyl 2-[(2S,6S)-6-methyl-3-oxooxan-2-yl]acetate |
| SMILES | COC(=O)C[C@@H]1O[C@@H](C)CCC1=O |
| InChI | InChI=1S/C9H14O4/c1-6-3-4-7(10)8(13-6)5-9(11)12-2/h6,8H,3-5H2,1-2H3/t6-,8-/m0/s1 |
| InChIKey | MXBFYLIXGZHMIH-XPUUQOCRSA-N |
| XLogP | 0.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |