C18H23NO3Se — CID 139265990
methyl 4-[benzyl-(2-methylselanyl-2-oxoethyl)amino]cyclohexene-1-carboxylate (PubChem CID 139265990) has the molecular formula C18H23NO3Se and a molecular weight of 380.35 g/mol. Its IUPAC name is methyl 4-[benzyl-(2-methylselanyl-2-oxoethyl)amino]cyclohexene-1-carboxylate.
| Compound Name | methyl 4-[benzyl-(2-methylselanyl-2-oxoethyl)amino]cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 139265990 |
| Molecular Formula | C18H23NO3Se |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | methyl 4-[benzyl-(2-methylselanyl-2-oxoethyl)amino]cyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=CCC(N(CC(=O)[Se]C)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H23NO3Se/c1-22-18(21)15-8-10-16(11-9-15)19(13-17(20)23-2)12-14-6-4-3-5-7-14/h3-8,16H,9-13H2,1-2H3 |
| InChIKey | CKGSXKYSSTUYDQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|