C12H16O2Se — CID 139266088
(1R,6S)-7,7,9,9-tetramethyl-8,11-dioxa-10-selenatetracyclo[4.3.1.12,5.01,6]undec-3-ene (PubChem CID 139266088) has the molecular formula C12H16O2Se and a molecular weight of 271.22 g/mol. Its IUPAC name is (1R,6S)-7,7,9,9-tetramethyl-8,11-dioxa-10-selenatetracyclo[4.3.1.12,5.01,6]undec-3-ene.
| Compound Name | (1R,6S)-7,7,9,9-tetramethyl-8,11-dioxa-10-selenatetracyclo[4.3.1.12,5.01,6]undec-3-ene |
|---|---|
| PubChem CID | 139266088 |
| Molecular Formula | C12H16O2Se |
| Molecular Weight | 271.22 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | (1R,6S)-7,7,9,9-tetramethyl-8,11-dioxa-10-selenatetracyclo[4.3.1.12,5.01,6]undec-3-ene |
| SMILES | CC1(C)OC(C)(C)[C@]23[Se][C@]12C1C=CC3O1 |
| InChI | InChI=1S/C12H16O2Se/c1-9(2)11-7-5-6-8(13-7)12(11,15-11)10(3,4)14-9/h5-8H,1-4H3/t7?,8?,11-,12+ |
| InChIKey | BXGWVAXZKQHYIW-MRUWNMPWSA-N |
| XLogP | 1.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|