C19H28OSe — CID 139266394
3,3-dimethyl-1-(1-methylselanyl-4-phenylcyclohexyl)butan-2-one (PubChem CID 139266394) has the molecular formula C19H28OSe and a molecular weight of 351.39 g/mol. Its IUPAC name is 3,3-dimethyl-1-(1-methylselanyl-4-phenylcyclohexyl)butan-2-one.
| Compound Name | 3,3-dimethyl-1-(1-methylselanyl-4-phenylcyclohexyl)butan-2-one |
|---|---|
| PubChem CID | 139266394 |
| Molecular Formula | C19H28OSe |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 3,3-dimethyl-1-(1-methylselanyl-4-phenylcyclohexyl)butan-2-one |
| SMILES | C[Se]C1(CC(=O)C(C)(C)C)CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H28OSe/c1-18(2,3)17(20)14-19(21-4)12-10-16(11-13-19)15-8-6-5-7-9-15/h5-9,16H,10-14H2,1-4H3 |
| InChIKey | NFYKDIFHXDBASM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|