C18H23NSe — CID 139266431
N,N-dimethyl-1-[2-[(E)-3-phenylprop-2-enyl]selanylcyclopenta-2,4-dien-1-yl]ethanamine (PubChem CID 139266431) has the molecular formula C18H23NSe and a molecular weight of 332.35 g/mol. Its IUPAC name is N,N-dimethyl-1-[2-[(E)-3-phenylprop-2-enyl]selanylcyclopenta-2,4-dien-1-yl]ethanamine.
| Compound Name | N,N-dimethyl-1-[2-[(E)-3-phenylprop-2-enyl]selanylcyclopenta-2,4-dien-1-yl]ethanamine |
|---|---|
| PubChem CID | 139266431 |
| Molecular Formula | C18H23NSe |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | N,N-dimethyl-1-[2-[(E)-3-phenylprop-2-enyl]selanylcyclopenta-2,4-dien-1-yl]ethanamine |
| SMILES | CC(C1C=CC=C1[Se]C/C=C/c1ccccc1)N(C)C |
| InChI | InChI=1S/C18H23NSe/c1-15(19(2)3)17-12-7-13-18(17)20-14-8-11-16-9-5-4-6-10-16/h4-13,15,17H,14H2,1-3H3/b11-8+ |
| InChIKey | KGHKJUFVLZRSKW-DHZHZOJOSA-N |
| XLogP | 3.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|