C14H23NOSe — CID 101081109
(1R)-N,N-dimethyl-1-[2-[[(2R)-oxolan-2-yl]methylselanyl]cyclopenta-2,4-dien-1-yl]ethanamine (PubChem CID 101081109) has the molecular formula C14H23NOSe and a molecular weight of 300.30 g/mol. Its IUPAC name is (1R)-N,N-dimethyl-1-[2-[[(2R)-oxolan-2-yl]methylselanyl]cyclopenta-2,4-dien-1-yl]ethanamine.
| Compound Name | (1R)-N,N-dimethyl-1-[2-[[(2R)-oxolan-2-yl]methylselanyl]cyclopenta-2,4-dien-1-yl]ethanamine |
|---|---|
| PubChem CID | 101081109 |
| Molecular Formula | C14H23NOSe |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | (1R)-N,N-dimethyl-1-[2-[[(2R)-oxolan-2-yl]methylselanyl]cyclopenta-2,4-dien-1-yl]ethanamine |
| SMILES | C[C@H](C1C=CC=C1[Se]C[C@H]1CCCO1)N(C)C |
| InChI | InChI=1S/C14H23NOSe/c1-11(15(2)3)13-7-4-8-14(13)17-10-12-6-5-9-16-12/h4,7-8,11-13H,5-6,9-10H2,1-3H3/t11-,12-,13?/m1/s1 |
| InChIKey | ZMKYCALXWOLZIC-ZNRZSNADSA-N |
| XLogP | 2.31 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|