About tris(4-hydroxybutanoyloxy)methyl 4-hydroxybutanoate
tris(4-hydroxybutanoyloxy)methyl 4-hydroxybutanoate (PubChem CID 139267372) has the molecular formula C17H28O12
and a molecular weight of 424.40 g/mol. Its IUPAC name is tris(4-hydroxybutanoyloxy)methyl 4-hydroxybutanoate.
Molecular Properties
| Compound Name | tris(4-hydroxybutanoyloxy)methyl 4-hydroxybutanoate |
| PubChem CID | 139267372 |
| Molecular Formula | C17H28O12 |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | tris(4-hydroxybutanoyloxy)methyl 4-hydroxybutanoate |
| SMILES | O=C(CCCO)OC(OC(=O)CCCO)(OC(=O)CCCO)OC(=O)CCCO |
| InChI | InChI=1S/C17H28O12/c18-9-1-5-13(22)26-17(27-14(23)6-2-10-19,28-15(24)7-3-11-20)29-16(25)8-4-12-21/h18-21H,1-12H2 |
| InChIKey | TUECSIOWPUKPSV-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 186.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze tris(4-hydroxybutanoyloxy)methyl 4-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(4-hydroxybutanoyloxy)methyl 4-hydroxybutanoate?
The IUPAC name of tris(4-hydroxybutanoyloxy)methyl 4-hydroxybutanoate (CID 139267372) is tris(4-hydroxybutanoyloxy)methyl 4-hydroxybutanoate.
What is the SMILES notation for tris(4-hydroxybutanoyloxy)methyl 4-hydroxybutanoate?
The canonical SMILES for tris(4-hydroxybutanoyloxy)methyl 4-hydroxybutanoate is O=C(CCCO)OC(OC(=O)CCCO)(OC(=O)CCCO)OC(=O)CCCO.
What is the InChIKey of tris(4-hydroxybutanoyloxy)methyl 4-hydroxybutanoate?
The InChIKey is TUECSIOWPUKPSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O12/c18-9-1-5-13(22)26-17(27-14(23)6-2-10-19,28-15(24)7-3-11-20)29-16(25)8-4-12-21/h18-21H,1-12H2.
What are the key properties of tris(4-hydroxybutanoyloxy)methyl 4-hydroxybutanoate?
tris(4-hydroxybutanoyloxy)methyl 4-hydroxybutanoate has a molecular weight of 424.40 g/mol, XLogP of -1.14, 16 rotatable bonds, 4 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for tris(4-hydroxybutanoyloxy)methyl 4-hydroxybutanoate is sourced from PubChem (CID 139267372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).