About bis(4-hydroxybutanoyloxy)bismuthanyl 4-hydroxybutanoate
bis(4-hydroxybutanoyloxy)bismuthanyl 4-hydroxybutanoate (PubChem CID 141066458) has the molecular formula C12H21BiO9
and a molecular weight of 518.27 g/mol. Its IUPAC name is bis(4-hydroxybutanoyloxy)bismuthanyl 4-hydroxybutanoate.
Molecular Properties
| Compound Name | bis(4-hydroxybutanoyloxy)bismuthanyl 4-hydroxybutanoate |
| PubChem CID | 141066458 |
| Molecular Formula | C12H21BiO9 |
| Molecular Weight | 518.27 g/mol |
| Exact Mass | 518.10 |
| IUPAC Name | bis(4-hydroxybutanoyloxy)bismuthanyl 4-hydroxybutanoate |
| SMILES | O=C(CCCO)O[Bi](OC(=O)CCCO)OC(=O)CCCO |
| InChI | InChI=1S/3C4H8O3.Bi/c3*5-3-1-2-4(6)7;/h3*5H,1-3H2,(H,6,7);/q;;;+3/p-3 |
| InChIKey | SXPRFJXDDZEEHT-UHFFFAOYSA-K |
| XLogP | -1.08 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 518.27 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze bis(4-hydroxybutanoyloxy)bismuthanyl 4-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-hydroxybutanoyloxy)bismuthanyl 4-hydroxybutanoate?
The IUPAC name of bis(4-hydroxybutanoyloxy)bismuthanyl 4-hydroxybutanoate (CID 141066458) is bis(4-hydroxybutanoyloxy)bismuthanyl 4-hydroxybutanoate.
What is the SMILES notation for bis(4-hydroxybutanoyloxy)bismuthanyl 4-hydroxybutanoate?
The canonical SMILES for bis(4-hydroxybutanoyloxy)bismuthanyl 4-hydroxybutanoate is O=C(CCCO)O[Bi](OC(=O)CCCO)OC(=O)CCCO.
What is the InChIKey of bis(4-hydroxybutanoyloxy)bismuthanyl 4-hydroxybutanoate?
The InChIKey is SXPRFJXDDZEEHT-UHFFFAOYSA-K. The full InChI is InChI=1S/3C4H8O3.Bi/c3*5-3-1-2-4(6)7;/h3*5H,1-3H2,(H,6,7);/q;;;+3/p-3.
What are the key properties of bis(4-hydroxybutanoyloxy)bismuthanyl 4-hydroxybutanoate?
bis(4-hydroxybutanoyloxy)bismuthanyl 4-hydroxybutanoate has a molecular weight of 518.27 g/mol, XLogP of -1.08, 12 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-hydroxybutanoyloxy)bismuthanyl 4-hydroxybutanoate is sourced from PubChem (CID 141066458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).