About (2-oxoazetidin-1-yl) 4-hydroxybutanoate
(2-oxoazetidin-1-yl) 4-hydroxybutanoate (PubChem CID 86754919) has the molecular formula C7H11NO4
and a molecular weight of 173.17 g/mol. Its IUPAC name is (2-oxoazetidin-1-yl) 4-hydroxybutanoate.
Molecular Properties
| Compound Name | (2-oxoazetidin-1-yl) 4-hydroxybutanoate |
| PubChem CID | 86754919 |
| Molecular Formula | C7H11NO4 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | (2-oxoazetidin-1-yl) 4-hydroxybutanoate |
| SMILES | O=C(CCCO)ON1CCC1=O |
| InChI | InChI=1S/C7H11NO4/c9-5-1-2-7(11)12-8-4-3-6(8)10/h9H,1-5H2 |
| InChIKey | YWZDQPMTGNNMJA-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-oxoazetidin-1-yl) 4-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxoazetidin-1-yl) 4-hydroxybutanoate?
The IUPAC name of (2-oxoazetidin-1-yl) 4-hydroxybutanoate (CID 86754919) is (2-oxoazetidin-1-yl) 4-hydroxybutanoate.
What is the SMILES notation for (2-oxoazetidin-1-yl) 4-hydroxybutanoate?
The canonical SMILES for (2-oxoazetidin-1-yl) 4-hydroxybutanoate is O=C(CCCO)ON1CCC1=O.
What is the InChIKey of (2-oxoazetidin-1-yl) 4-hydroxybutanoate?
The InChIKey is YWZDQPMTGNNMJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO4/c9-5-1-2-7(11)12-8-4-3-6(8)10/h9H,1-5H2.
What are the key properties of (2-oxoazetidin-1-yl) 4-hydroxybutanoate?
(2-oxoazetidin-1-yl) 4-hydroxybutanoate has a molecular weight of 173.17 g/mol, XLogP of -0.55, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxoazetidin-1-yl) 4-hydroxybutanoate is sourced from PubChem (CID 86754919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).