C8H8N2O2S2 — CID 139269793
6-methyl-2-methylsulfonyl-[1,3]thiazolo[4,5-b]pyridine (PubChem CID 139269793) has the molecular formula C8H8N2O2S2 and a molecular weight of 228.30 g/mol. Its IUPAC name is 6-methyl-2-methylsulfonyl-[1,3]thiazolo[4,5-b]pyridine.
| Compound Name | 6-methyl-2-methylsulfonyl-[1,3]thiazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 139269793 |
| Molecular Formula | C8H8N2O2S2 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | 6-methyl-2-methylsulfonyl-[1,3]thiazolo[4,5-b]pyridine |
| SMILES | Cc1cnc2nc(S(C)(=O)=O)sc2c1 |
| InChI | InChI=1S/C8H8N2O2S2/c1-5-3-6-7(9-4-5)10-8(13-6)14(2,11)12/h3-4H,1-2H3 |
| InChIKey | CFMAVWIRKYFMMF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |