C12H15NO2S2 — CID 167214872
5-(2-methylpropyl)-2-methylsulfonyl-1,3-benzothiazole (PubChem CID 167214872) has the molecular formula C12H15NO2S2 and a molecular weight of 269.39 g/mol. Its IUPAC name is 5-(2-methylpropyl)-2-methylsulfonyl-1,3-benzothiazole.
| Compound Name | 5-(2-methylpropyl)-2-methylsulfonyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 167214872 |
| Molecular Formula | C12H15NO2S2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 5-(2-methylpropyl)-2-methylsulfonyl-1,3-benzothiazole |
| SMILES | CC(C)Cc1ccc2sc(S(C)(=O)=O)nc2c1 |
| InChI | InChI=1S/C12H15NO2S2/c1-8(2)6-9-4-5-11-10(7-9)13-12(16-11)17(3,14)15/h4-5,7-8H,6H2,1-3H3 |
| InChIKey | OLVSEAKGKWIWCV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |