About 6-(2-methylpropyl)-1,2,3,4-benzotetrazine
6-(2-methylpropyl)-1,2,3,4-benzotetrazine (PubChem CID 138666997) has the molecular formula C10H12N4
and a molecular weight of 188.23 g/mol. Its IUPAC name is 6-(2-methylpropyl)-1,2,3,4-benzotetrazine.
Molecular Properties
| Compound Name | 6-(2-methylpropyl)-1,2,3,4-benzotetrazine |
| PubChem CID | 138666997 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 6-(2-methylpropyl)-1,2,3,4-benzotetrazine |
| SMILES | CC(C)Cc1ccc2nnnnc2c1 |
| InChI | InChI=1S/C10H12N4/c1-7(2)5-8-3-4-9-10(6-8)12-14-13-11-9/h3-4,6-7H,5H2,1-2H3 |
| InChIKey | WXZRIXIATRWQQT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(2-methylpropyl)-1,2,3,4-benzotetrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-methylpropyl)-1,2,3,4-benzotetrazine?
The IUPAC name of 6-(2-methylpropyl)-1,2,3,4-benzotetrazine (CID 138666997) is 6-(2-methylpropyl)-1,2,3,4-benzotetrazine.
What is the SMILES notation for 6-(2-methylpropyl)-1,2,3,4-benzotetrazine?
The canonical SMILES for 6-(2-methylpropyl)-1,2,3,4-benzotetrazine is CC(C)Cc1ccc2nnnnc2c1.
What is the InChIKey of 6-(2-methylpropyl)-1,2,3,4-benzotetrazine?
The InChIKey is WXZRIXIATRWQQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4/c1-7(2)5-8-3-4-9-10(6-8)12-14-13-11-9/h3-4,6-7H,5H2,1-2H3.
What are the key properties of 6-(2-methylpropyl)-1,2,3,4-benzotetrazine?
6-(2-methylpropyl)-1,2,3,4-benzotetrazine has a molecular weight of 188.23 g/mol, XLogP of 1.62, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-methylpropyl)-1,2,3,4-benzotetrazine is sourced from PubChem (CID 138666997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).