About trans-(3S,5S)-1,1-difluoro-3-(methylsulfanylmethyl)-5-(trifluoromethyl)cyclohexane
trans-(3S,5S)-1,1-difluoro-3-(methylsulfanylmethyl)-5-(trifluoromethyl)cyclohexane (PubChem CID 139292427) has the molecular formula C9H13F5S
and a molecular weight of 248.26 g/mol. Its IUPAC name is trans-(3S,5S)-1,1-difluoro-3-(methylsulfanylmethyl)-5-(trifluoromethyl)cyclohexane.
Molecular Properties
| Compound Name | trans-(3S,5S)-1,1-difluoro-3-(methylsulfanylmethyl)-5-(trifluoromethyl)cyclohexane |
| PubChem CID | 139292427 |
| Molecular Formula | C9H13F5S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | trans-(3S,5S)-1,1-difluoro-3-(methylsulfanylmethyl)-5-(trifluoromethyl)cyclohexane |
| SMILES | CSC[C@H]1C[C@H](C(F)(F)F)CC(F)(F)C1 |
| InChI | InChI=1S/C9H13F5S/c1-15-5-6-2-7(9(12,13)14)4-8(10,11)3-6/h6-7H,2-5H2,1H3/t6-,7-/m0/s1 |
| InChIKey | CQTTZXHOAZCILS-BQBZGAKWSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze trans-(3S,5S)-1,1-difluoro-3-(methylsulfanylmethyl)-5-(trifluoromethyl)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(3S,5S)-1,1-difluoro-3-(methylsulfanylmethyl)-5-(trifluoromethyl)cyclohexane?
The IUPAC name of trans-(3S,5S)-1,1-difluoro-3-(methylsulfanylmethyl)-5-(trifluoromethyl)cyclohexane (CID 139292427) is trans-(3S,5S)-1,1-difluoro-3-(methylsulfanylmethyl)-5-(trifluoromethyl)cyclohexane.
What is the SMILES notation for trans-(3S,5S)-1,1-difluoro-3-(methylsulfanylmethyl)-5-(trifluoromethyl)cyclohexane?
The canonical SMILES for trans-(3S,5S)-1,1-difluoro-3-(methylsulfanylmethyl)-5-(trifluoromethyl)cyclohexane is CSC[C@H]1C[C@H](C(F)(F)F)CC(F)(F)C1.
What is the InChIKey of trans-(3S,5S)-1,1-difluoro-3-(methylsulfanylmethyl)-5-(trifluoromethyl)cyclohexane?
The InChIKey is CQTTZXHOAZCILS-BQBZGAKWSA-N. The full InChI is InChI=1S/C9H13F5S/c1-15-5-6-2-7(9(12,13)14)4-8(10,11)3-6/h6-7H,2-5H2,1H3/t6-,7-/m0/s1.
What are the key properties of trans-(3S,5S)-1,1-difluoro-3-(methylsulfanylmethyl)-5-(trifluoromethyl)cyclohexane?
trans-(3S,5S)-1,1-difluoro-3-(methylsulfanylmethyl)-5-(trifluoromethyl)cyclohexane has a molecular weight of 248.26 g/mol, XLogP of 3.96, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(3S,5S)-1,1-difluoro-3-(methylsulfanylmethyl)-5-(trifluoromethyl)cyclohexane is sourced from PubChem (CID 139292427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).