About 3-ethyl-1,1-difluoro-5-(trifluoromethyl)cyclohexane
3-ethyl-1,1-difluoro-5-(trifluoromethyl)cyclohexane (PubChem CID 121407311) has the molecular formula C9H13F5
and a molecular weight of 216.19 g/mol. Its IUPAC name is 3-ethyl-1,1-difluoro-5-(trifluoromethyl)cyclohexane.
Analyze 3-ethyl-1,1-difluoro-5-(trifluoromethyl)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1,1-difluoro-5-(trifluoromethyl)cyclohexane?
The IUPAC name of 3-ethyl-1,1-difluoro-5-(trifluoromethyl)cyclohexane (CID 121407311) is 3-ethyl-1,1-difluoro-5-(trifluoromethyl)cyclohexane.
What is the SMILES notation for 3-ethyl-1,1-difluoro-5-(trifluoromethyl)cyclohexane?
The canonical SMILES for 3-ethyl-1,1-difluoro-5-(trifluoromethyl)cyclohexane is CCC1CC(C(F)(F)F)CC(F)(F)C1.
What is the InChIKey of 3-ethyl-1,1-difluoro-5-(trifluoromethyl)cyclohexane?
The InChIKey is DJPMRKSNQBLOLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F5/c1-2-6-3-7(9(12,13)14)5-8(10,11)4-6/h6-7H,2-5H2,1H3.
What are the key properties of 3-ethyl-1,1-difluoro-5-(trifluoromethyl)cyclohexane?
3-ethyl-1,1-difluoro-5-(trifluoromethyl)cyclohexane has a molecular weight of 216.19 g/mol, XLogP of 4.01, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1,1-difluoro-5-(trifluoromethyl)cyclohexane is sourced from PubChem (CID 121407311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).