C8H15FO6S — CID 139293451
2-fluoro-4-methoxy-1-oxo-1-propan-2-yloxybutane-2-sulfonic acid (PubChem CID 139293451) has the molecular formula C8H15FO6S and a molecular weight of 258.27 g/mol. Its IUPAC name is 2-fluoro-4-methoxy-1-oxo-1-propan-2-yloxybutane-2-sulfonic acid.
| Compound Name | 2-fluoro-4-methoxy-1-oxo-1-propan-2-yloxybutane-2-sulfonic acid |
|---|---|
| PubChem CID | 139293451 |
| Molecular Formula | C8H15FO6S |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2-fluoro-4-methoxy-1-oxo-1-propan-2-yloxybutane-2-sulfonic acid |
| SMILES | COCCC(F)(C(=O)OC(C)C)S(=O)(=O)O |
| InChI | InChI=1S/C8H15FO6S/c1-6(2)15-7(10)8(9,4-5-14-3)16(11,12)13/h6H,4-5H2,1-3H3,(H,11,12,13) |
| InChIKey | FMPQXIYOAJYEFK-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|