C6H11FO5S — CID 139293497
3-fluoro-1-methoxy-4-oxopentane-3-sulfonic acid (PubChem CID 139293497) has the molecular formula C6H11FO5S and a molecular weight of 214.21 g/mol. Its IUPAC name is 3-fluoro-1-methoxy-4-oxopentane-3-sulfonic acid.
| Compound Name | 3-fluoro-1-methoxy-4-oxopentane-3-sulfonic acid |
|---|---|
| PubChem CID | 139293497 |
| Molecular Formula | C6H11FO5S |
| Molecular Weight | 214.21 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 3-fluoro-1-methoxy-4-oxopentane-3-sulfonic acid |
| SMILES | COCCC(F)(C(C)=O)S(=O)(=O)O |
| InChI | InChI=1S/C6H11FO5S/c1-5(8)6(7,3-4-12-2)13(9,10)11/h3-4H2,1-2H3,(H,9,10,11) |
| InChIKey | GTOYTRZOVRKTRI-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.21 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|