C18H18F3N3O2S — CID 139293627
N-[(3R)-oxolan-3-yl]-2-[(6R)-3-sulfanylidene-6-(2,3,6-trifluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]acetamide (PubChem CID 139293627) has the molecular formula C18H18F3N3O2S and a molecular weight of 397.42 g/mol. Its IUPAC name is N-[(3R)-oxolan-3-yl]-2-[(6R)-3-sulfanylidene-6-(2,3,6-trifluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]acetamide.
| Compound Name | N-[(3R)-oxolan-3-yl]-2-[(6R)-3-sulfanylidene-6-(2,3,6-trifluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 139293627 |
| Molecular Formula | C18H18F3N3O2S |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | N-[(3R)-oxolan-3-yl]-2-[(6R)-3-sulfanylidene-6-(2,3,6-trifluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]acetamide |
| SMILES | O=C(Cc1[nH]c(=S)n2c1C[C@H](c1c(F)ccc(F)c1F)C2)N[C@@H]1CCOC1 |
| InChI | InChI=1S/C18H18F3N3O2S/c19-11-1-2-12(20)17(21)16(11)9-5-14-13(23-18(27)24(14)7-9)6-15(25)22-10-3-4-26-8-10/h1-2,9-10H,3-8H2,(H,22,25)(H,23,27)/t9-,10+/m0/s1 |
| InChIKey | FRUFABXVFXNGKT-VHSXEESVSA-N |
| XLogP | 2.75 |
| TPSA | 59.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|