C7H12O6S — CID 139296035
2-ethoxyethyl 2-oxo-1,3,2-dioxathiolane-4-carboxylate (PubChem CID 139296035) has the molecular formula C7H12O6S and a molecular weight of 224.23 g/mol. Its IUPAC name is 2-ethoxyethyl 2-oxo-1,3,2-dioxathiolane-4-carboxylate.
| Compound Name | 2-ethoxyethyl 2-oxo-1,3,2-dioxathiolane-4-carboxylate |
|---|---|
| PubChem CID | 139296035 |
| Molecular Formula | C7H12O6S |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 2-ethoxyethyl 2-oxo-1,3,2-dioxathiolane-4-carboxylate |
| SMILES | CCOCCOC(=O)C1COS(=O)O1 |
| InChI | InChI=1S/C7H12O6S/c1-2-10-3-4-11-7(8)6-5-12-14(9)13-6/h6H,2-5H2,1H3 |
| InChIKey | YUFMOFCVNMDPAL-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|