C14H18N2O2 — CID 139297112
[(7S)-5-amino-7-methyl-2-azabicyclo[2.2.1]heptan-2-yl] benzoate (PubChem CID 139297112) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is [(7S)-5-amino-7-methyl-2-azabicyclo[2.2.1]heptan-2-yl] benzoate.
| Compound Name | [(7S)-5-amino-7-methyl-2-azabicyclo[2.2.1]heptan-2-yl] benzoate |
|---|---|
| PubChem CID | 139297112 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | [(7S)-5-amino-7-methyl-2-azabicyclo[2.2.1]heptan-2-yl] benzoate |
| SMILES | C[C@H]1C2CN(OC(=O)c3ccccc3)C1CC2N |
| InChI | InChI=1S/C14H18N2O2/c1-9-11-8-16(13(9)7-12(11)15)18-14(17)10-5-3-2-4-6-10/h2-6,9,11-13H,7-8,15H2,1H3/t9-,11?,12?,13?/m0/s1 |
| InChIKey | FGJQNNPLDJMFMF-KODGCSJUSA-N |
| XLogP | 1.43 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |