C12H13I4NO — CID 139297247
2-methyl-N-[3-(1,1,2,2-tetraiodoethyl)phenyl]propanamide (PubChem CID 139297247) has the molecular formula C12H13I4NO and a molecular weight of 694.86 g/mol. Its IUPAC name is 2-methyl-N-[3-(1,1,2,2-tetraiodoethyl)phenyl]propanamide.
| Compound Name | 2-methyl-N-[3-(1,1,2,2-tetraiodoethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 139297247 |
| Molecular Formula | C12H13I4NO |
| Molecular Weight | 694.86 g/mol |
| Exact Mass | 694.72 |
| IUPAC Name | 2-methyl-N-[3-(1,1,2,2-tetraiodoethyl)phenyl]propanamide |
| SMILES | CC(C)C(=O)Nc1cccc(C(I)(I)C(I)I)c1 |
| InChI | InChI=1S/C12H13I4NO/c1-7(2)10(18)17-9-5-3-4-8(6-9)12(15,16)11(13)14/h3-7,11H,1-2H3,(H,17,18) |
| InChIKey | VXMIWXHWQCIZTO-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.86 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|