C10H9I4NO — CID 134337067
N-[3-(1,1,2,2-tetraiodoethyl)phenyl]acetamide (PubChem CID 134337067) has the molecular formula C10H9I4NO and a molecular weight of 666.80 g/mol. Its IUPAC name is N-[3-(1,1,2,2-tetraiodoethyl)phenyl]acetamide.
| Compound Name | N-[3-(1,1,2,2-tetraiodoethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 134337067 |
| Molecular Formula | C10H9I4NO |
| Molecular Weight | 666.80 g/mol |
| Exact Mass | 666.69 |
| IUPAC Name | N-[3-(1,1,2,2-tetraiodoethyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(C(I)(I)C(I)I)c1 |
| InChI | InChI=1S/C10H9I4NO/c1-6(16)15-8-4-2-3-7(5-8)10(13,14)9(11)12/h2-5,9H,1H3,(H,15,16) |
| InChIKey | TYIBYCNJXGDEOG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.80 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|