C10H8Cl3F2NO — CID 54366918
N-[3-(2,2,2-trichloro-1,1-difluoroethyl)phenyl]acetamide (PubChem CID 54366918) has the molecular formula C10H8Cl3F2NO and a molecular weight of 302.54 g/mol. Its IUPAC name is N-[3-(2,2,2-trichloro-1,1-difluoroethyl)phenyl]acetamide.
| Compound Name | N-[3-(2,2,2-trichloro-1,1-difluoroethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 54366918 |
| Molecular Formula | C10H8Cl3F2NO |
| Molecular Weight | 302.54 g/mol |
| Exact Mass | 300.96 |
| IUPAC Name | N-[3-(2,2,2-trichloro-1,1-difluoroethyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(C(F)(F)C(Cl)(Cl)Cl)c1 |
| InChI | InChI=1S/C10H8Cl3F2NO/c1-6(17)16-8-4-2-3-7(5-8)9(14,15)10(11,12)13/h2-5H,1H3,(H,16,17) |
| InChIKey | UQKXKFKXCJDODF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.54 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|