C15H14ClF2NO2 — CID 139604575
N-[3-[chloro(difluoro)methyl]phenyl]-2-(furan-2-yl)-2-methylpropanamide (PubChem CID 139604575) has the molecular formula C15H14ClF2NO2 and a molecular weight of 313.73 g/mol. Its IUPAC name is N-[3-[chloro(difluoro)methyl]phenyl]-2-(furan-2-yl)-2-methylpropanamide.
| Compound Name | N-[3-[chloro(difluoro)methyl]phenyl]-2-(furan-2-yl)-2-methylpropanamide |
|---|---|
| PubChem CID | 139604575 |
| Molecular Formula | C15H14ClF2NO2 |
| Molecular Weight | 313.73 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | N-[3-[chloro(difluoro)methyl]phenyl]-2-(furan-2-yl)-2-methylpropanamide |
| SMILES | CC(C)(C(=O)Nc1cccc(C(F)(F)Cl)c1)c1ccco1 |
| InChI | InChI=1S/C15H14ClF2NO2/c1-14(2,12-7-4-8-21-12)13(20)19-11-6-3-5-10(9-11)15(16,17)18/h3-9H,1-2H3,(H,19,20) |
| InChIKey | DKONIOPCJWKNHO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.73 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|