C14H12ClF2NO2 — CID 139604585
N-[3-[chloro(difluoro)methyl]phenyl]-2-(furan-2-yl)propanamide (PubChem CID 139604585) has the molecular formula C14H12ClF2NO2 and a molecular weight of 299.70 g/mol. Its IUPAC name is N-[3-[chloro(difluoro)methyl]phenyl]-2-(furan-2-yl)propanamide.
| Compound Name | N-[3-[chloro(difluoro)methyl]phenyl]-2-(furan-2-yl)propanamide |
|---|---|
| PubChem CID | 139604585 |
| Molecular Formula | C14H12ClF2NO2 |
| Molecular Weight | 299.70 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | N-[3-[chloro(difluoro)methyl]phenyl]-2-(furan-2-yl)propanamide |
| SMILES | CC(C(=O)Nc1cccc(C(F)(F)Cl)c1)c1ccco1 |
| InChI | InChI=1S/C14H12ClF2NO2/c1-9(12-6-3-7-20-12)13(19)18-11-5-2-4-10(8-11)14(15,16)17/h2-9H,1H3,(H,18,19) |
| InChIKey | PHRHPCLKTSNBIQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.70 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|