C11H25NS — CID 139297860
N-(2,4-dimethylpentan-3-yl)-N-(2-methylpropyl)thiohydroxylamine (PubChem CID 139297860) has the molecular formula C11H25NS and a molecular weight of 203.39 g/mol. Its IUPAC name is N-(2,4-dimethylpentan-3-yl)-N-(2-methylpropyl)thiohydroxylamine.
| Compound Name | N-(2,4-dimethylpentan-3-yl)-N-(2-methylpropyl)thiohydroxylamine |
|---|---|
| PubChem CID | 139297860 |
| Molecular Formula | C11H25NS |
| Molecular Weight | 203.39 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | N-(2,4-dimethylpentan-3-yl)-N-(2-methylpropyl)thiohydroxylamine |
| SMILES | CC(C)CN(S)C(C(C)C)C(C)C |
| InChI | InChI=1S/C11H25NS/c1-8(2)7-12(13)11(9(3)4)10(5)6/h8-11,13H,7H2,1-6H3 |
| InChIKey | SQGCJDHAGQYRFY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|