C11H24N4O4 — CID 139298084
(3S,4R)-6-[2-azidoethyl(methyl)amino]-1-methoxy-5-methylhexane-2,3,4-triol (PubChem CID 139298084) has the molecular formula C11H24N4O4 and a molecular weight of 276.34 g/mol. Its IUPAC name is (3S,4R)-6-[2-azidoethyl(methyl)amino]-1-methoxy-5-methylhexane-2,3,4-triol.
| Compound Name | (3S,4R)-6-[2-azidoethyl(methyl)amino]-1-methoxy-5-methylhexane-2,3,4-triol |
|---|---|
| PubChem CID | 139298084 |
| Molecular Formula | C11H24N4O4 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | (3S,4R)-6-[2-azidoethyl(methyl)amino]-1-methoxy-5-methylhexane-2,3,4-triol |
| SMILES | COCC(O)[C@@H](O)[C@H](O)C(C)CN(C)CCN=[N+]=[N-] |
| InChI | InChI=1S/C11H24N4O4/c1-8(6-15(2)5-4-13-14-12)10(17)11(18)9(16)7-19-3/h8-11,16-18H,4-7H2,1-3H3/t8?,9?,10-,11-/m1/s1 |
| InChIKey | UKXSMZWHDJPULL-JPPWEJMLSA-N |
| XLogP | -0.41 |
| TPSA | 121.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|