C43H33N5 — CID 139298890
2-[4-[2-[3,5-bis[2-(1H-pyrazol-4-yl)phenyl]phenyl]-4,5-dimethylphenyl]phenyl]pyridine (PubChem CID 139298890) has the molecular formula C43H33N5 and a molecular weight of 619.77 g/mol. Its IUPAC name is 2-[4-[2-[3,5-bis[2-(1H-pyrazol-4-yl)phenyl]phenyl]-4,5-dimethylphenyl]phenyl]pyridine.
| Compound Name | 2-[4-[2-[3,5-bis[2-(1H-pyrazol-4-yl)phenyl]phenyl]-4,5-dimethylphenyl]phenyl]pyridine |
|---|---|
| PubChem CID | 139298890 |
| Molecular Formula | C43H33N5 |
| Molecular Weight | 619.77 g/mol |
| Exact Mass | 619.27 |
| IUPAC Name | 2-[4-[2-[3,5-bis[2-(1H-pyrazol-4-yl)phenyl]phenyl]-4,5-dimethylphenyl]phenyl]pyridine |
| SMILES | Cc1cc(-c2ccc(-c3ccccn3)cc2)c(-c2cc(-c3ccccc3-c3cn[nH]c3)cc(-c3ccccc3-c3cn[nH]c3)c2)cc1C |
| InChI | InChI=1S/C43H33N5/c1-28-19-41(30-14-16-31(17-15-30)43-13-7-8-18-44-43)42(20-29(28)2)34-22-32(37-9-3-5-11-39(37)35-24-45-46-25-35)21-33(23-34)38-10-4-6-12-40(38)36-26-47-48-27-36/h3-27H,1-2H3,(H,45,46)(H,47,48) |
| InChIKey | JRXNTVCBEPZZDV-UHFFFAOYSA-N |
| XLogP | 10.81 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.77 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |