C18H24ClF2N3O2 — CID 139300068
1-[4-[2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]-4-hydroxypiperidin-1-yl]ethanone (PubChem CID 139300068) has the molecular formula C18H24ClF2N3O2 and a molecular weight of 387.86 g/mol. Its IUPAC name is 1-[4-[2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]-4-hydroxypiperidin-1-yl]ethanone.
| Compound Name | 1-[4-[2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]-4-hydroxypiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 139300068 |
| Molecular Formula | C18H24ClF2N3O2 |
| Molecular Weight | 387.86 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 1-[4-[2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]-4-hydroxypiperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(O)(c2cc(Cl)nc(NC3CCC(F)(F)CC3)c2)CC1 |
| InChI | InChI=1S/C18H24ClF2N3O2/c1-12(25)24-8-6-17(26,7-9-24)13-10-15(19)23-16(11-13)22-14-2-4-18(20,21)5-3-14/h10-11,14,26H,2-9H2,1H3,(H,22,23) |
| InChIKey | JNKNJBGCZIKNDR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.86 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|