About [2-[(4,4-difluorocyclohexyl)amino]-6-[3-(fluoromethyl)pyrazol-1-yl]-4-pyridinyl]methylcarbamic acid
[2-[(4,4-difluorocyclohexyl)amino]-6-[3-(fluoromethyl)pyrazol-1-yl]-4-pyridinyl]methylcarbamic acid (PubChem CID 139300369) has the molecular formula C17H20F3N5O2
and a molecular weight of 383.37 g/mol. Its IUPAC name is [2-[(4,4-difluorocyclohexyl)amino]-6-[3-(fluoromethyl)pyrazol-1-yl]-4-pyridinyl]methylcarbamic acid.
Molecular Properties
| Compound Name | [2-[(4,4-difluorocyclohexyl)amino]-6-[3-(fluoromethyl)pyrazol-1-yl]-4-pyridinyl]methylcarbamic acid |
| PubChem CID | 139300369 |
| Molecular Formula | C17H20F3N5O2 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | [2-[(4,4-difluorocyclohexyl)amino]-6-[3-(fluoromethyl)pyrazol-1-yl]-4-pyridinyl]methylcarbamic acid |
| SMILES | O=C(O)NCc1cc(NC2CCC(F)(F)CC2)nc(-n2ccc(CF)n2)c1 |
| InChI | InChI=1S/C17H20F3N5O2/c18-9-13-3-6-25(24-13)15-8-11(10-21-16(26)27)7-14(23-15)22-12-1-4-17(19,20)5-2-12/h3,6-8,12,21H,1-2,4-5,9-10H2,(H,22,23)(H,26,27) |
| InChIKey | LLUPWTZQXXWZNX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[(4,4-difluorocyclohexyl)amino]-6-[3-(fluoromethyl)pyrazol-1-yl]-4-pyridinyl]methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4,4-difluorocyclohexyl)amino]-6-[3-(fluoromethyl)pyrazol-1-yl]-4-pyridinyl]methylcarbamic acid?
The IUPAC name of [2-[(4,4-difluorocyclohexyl)amino]-6-[3-(fluoromethyl)pyrazol-1-yl]-4-pyridinyl]methylcarbamic acid (CID 139300369) is [2-[(4,4-difluorocyclohexyl)amino]-6-[3-(fluoromethyl)pyrazol-1-yl]-4-pyridinyl]methylcarbamic acid.
What is the SMILES notation for [2-[(4,4-difluorocyclohexyl)amino]-6-[3-(fluoromethyl)pyrazol-1-yl]-4-pyridinyl]methylcarbamic acid?
The canonical SMILES for [2-[(4,4-difluorocyclohexyl)amino]-6-[3-(fluoromethyl)pyrazol-1-yl]-4-pyridinyl]methylcarbamic acid is O=C(O)NCc1cc(NC2CCC(F)(F)CC2)nc(-n2ccc(CF)n2)c1.
What is the InChIKey of [2-[(4,4-difluorocyclohexyl)amino]-6-[3-(fluoromethyl)pyrazol-1-yl]-4-pyridinyl]methylcarbamic acid?
The InChIKey is LLUPWTZQXXWZNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20F3N5O2/c18-9-13-3-6-25(24-13)15-8-11(10-21-16(26)27)7-14(23-15)22-12-1-4-17(19,20)5-2-12/h3,6-8,12,21H,1-2,4-5,9-10H2,(H,22,23)(H,26,27).
What are the key properties of [2-[(4,4-difluorocyclohexyl)amino]-6-[3-(fluoromethyl)pyrazol-1-yl]-4-pyridinyl]methylcarbamic acid?
[2-[(4,4-difluorocyclohexyl)amino]-6-[3-(fluoromethyl)pyrazol-1-yl]-4-pyridinyl]methylcarbamic acid has a molecular weight of 383.37 g/mol, XLogP of 3.49, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4,4-difluorocyclohexyl)amino]-6-[3-(fluoromethyl)pyrazol-1-yl]-4-pyridinyl]methylcarbamic acid is sourced from PubChem (CID 139300369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).