C9H16N2 — CID 139308350
1-cyclopropyl-5-propan-2-yl-4,5-dihydroimidazole (PubChem CID 139308350) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 1-cyclopropyl-5-propan-2-yl-4,5-dihydroimidazole.
| Compound Name | 1-cyclopropyl-5-propan-2-yl-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 139308350 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 1-cyclopropyl-5-propan-2-yl-4,5-dihydroimidazole |
| SMILES | CC(C)C1CN=CN1C1CC1 |
| InChI | InChI=1S/C9H16N2/c1-7(2)9-5-10-6-11(9)8-3-4-8/h6-9H,3-5H2,1-2H3 |
| InChIKey | KEHFLGKLUPNFQX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |