C8H12N2 — CID 90837373
2,4-diazatricyclo[5.2.1.02,6]dec-3-ene (PubChem CID 90837373) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is 2,4-diazatricyclo[5.2.1.02,6]dec-3-ene.
| Compound Name | 2,4-diazatricyclo[5.2.1.02,6]dec-3-ene |
|---|---|
| PubChem CID | 90837373 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 2,4-diazatricyclo[5.2.1.02,6]dec-3-ene |
| SMILES | C1=NCC2C3CCC(C3)N12 |
| InChI | InChI=1S/C8H12N2/c1-2-7-3-6(1)8-4-9-5-10(7)8/h5-8H,1-4H2 |
| InChIKey | DMCSYMOYWQSEJI-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |