C11H20N2 — CID 153219055
1,5,6,7,8,9,10,11,12,12a-decahydroimidazo[1,5-a]azecine (PubChem CID 153219055) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 1,5,6,7,8,9,10,11,12,12a-decahydroimidazo[1,5-a]azecine.
| Compound Name | 1,5,6,7,8,9,10,11,12,12a-decahydroimidazo[1,5-a]azecine |
|---|---|
| PubChem CID | 153219055 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1,5,6,7,8,9,10,11,12,12a-decahydroimidazo[1,5-a]azecine |
| SMILES | C1=NCC2CCCCCCCCN12 |
| InChI | InChI=1S/C11H20N2/c1-2-4-6-8-13-10-12-9-11(13)7-5-3-1/h10-11H,1-9H2 |
| InChIKey | WNHBTAHLRPDJJF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |