C12H22N2 — CID 70133276
4,5,6,7,8,10,11,12,13,13a-decahydro-1H-pyrido[1,2-a][1,4]diazecine (PubChem CID 70133276) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 4,5,6,7,8,10,11,12,13,13a-decahydro-1H-pyrido[1,2-a][1,4]diazecine.
| Compound Name | 4,5,6,7,8,10,11,12,13,13a-decahydro-1H-pyrido[1,2-a][1,4]diazecine |
|---|---|
| PubChem CID | 70133276 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 4,5,6,7,8,10,11,12,13,13a-decahydro-1H-pyrido[1,2-a][1,4]diazecine |
| SMILES | C1=N/CC2CCCCN2CCCCC/1 |
| InChI | InChI=1S/C12H22N2/c1-2-5-9-14-10-6-3-7-12(14)11-13-8-4-1/h8,12H,1-7,9-11H2/b13-8+ |
| InChIKey | ZYJNBQVMCUAPJI-MDWZMJQESA-N |
| XLogP | 2.49 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |