C10H13N3 — CID 123366968
1,5,6,6a,10a,10b-hexahydroimidazo[5,1-a][2,6]naphthyridine (PubChem CID 123366968) has the molecular formula C10H13N3 and a molecular weight of 175.24 g/mol. Its IUPAC name is 1,5,6,6a,10a,10b-hexahydroimidazo[5,1-a][2,6]naphthyridine.
| Compound Name | 1,5,6,6a,10a,10b-hexahydroimidazo[5,1-a][2,6]naphthyridine |
|---|---|
| PubChem CID | 123366968 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 1,5,6,6a,10a,10b-hexahydroimidazo[5,1-a][2,6]naphthyridine |
| SMILES | C1=CC2C(C=N1)CCN1C=NCC21 |
| InChI | InChI=1S/C10H13N3/c1-3-11-5-8-2-4-13-7-12-6-10(13)9(1)8/h1,3,5,7-10H,2,4,6H2 |
| InChIKey | BGHFWKVOLUUNDM-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |