C8H15N — CID 142494914
(3R)-3-propan-2-yl-2,3,4,5-tetrahydropyridine (PubChem CID 142494914) has the molecular formula C8H15N and a molecular weight of 125.21 g/mol. Its IUPAC name is (3R)-3-propan-2-yl-2,3,4,5-tetrahydropyridine.
| Compound Name | (3R)-3-propan-2-yl-2,3,4,5-tetrahydropyridine |
|---|---|
| PubChem CID | 142494914 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | (3R)-3-propan-2-yl-2,3,4,5-tetrahydropyridine |
| SMILES | CC(C)[C@H]1CCC=NC1 |
| InChI | InChI=1S/C8H15N/c1-7(2)8-4-3-5-9-6-8/h5,7-8H,3-4,6H2,1-2H3/t8-/m0/s1 |
| InChIKey | OPMOCMUIIDJPOO-QMMMGPOBSA-N |
| XLogP | 2.12 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |