C7H13NO — CID 15273915
5-propan-2-yl-5,6-dihydro-4H-1,3-oxazine (PubChem CID 15273915) has the molecular formula C7H13NO and a molecular weight of 127.19 g/mol. Its IUPAC name is 5-propan-2-yl-5,6-dihydro-4H-1,3-oxazine.
| Compound Name | 5-propan-2-yl-5,6-dihydro-4H-1,3-oxazine |
|---|---|
| PubChem CID | 15273915 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | 5-propan-2-yl-5,6-dihydro-4H-1,3-oxazine |
| SMILES | CC(C)C1CN=COC1 |
| InChI | InChI=1S/C7H13NO/c1-6(2)7-3-8-5-9-4-7/h5-7H,3-4H2,1-2H3 |
| InChIKey | UOYTZNSSXNTMCE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |