About 6-propan-2-yl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole
6-propan-2-yl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole (PubChem CID 140739944) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 6-propan-2-yl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole.
Analyze 6-propan-2-yl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propan-2-yl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole?
The IUPAC name of 6-propan-2-yl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole (CID 140739944) is 6-propan-2-yl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole.
What is the SMILES notation for 6-propan-2-yl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole?
The canonical SMILES for 6-propan-2-yl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole is CC(C)C1CCC2N=COC2C1.
What is the InChIKey of 6-propan-2-yl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole?
The InChIKey is VZLNQQOACJMHFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c1-7(2)8-3-4-9-10(5-8)12-6-11-9/h6-10H,3-5H2,1-2H3.
What are the key properties of 6-propan-2-yl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole?
6-propan-2-yl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole has a molecular weight of 167.25 g/mol, XLogP of 2.24, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propan-2-yl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole is sourced from PubChem (CID 140739944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).