C9H14O2 — CID 89076528
2-ethynyl-5-propan-2-yl-1,3-dioxane (PubChem CID 89076528) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is 2-ethynyl-5-propan-2-yl-1,3-dioxane.
| Compound Name | 2-ethynyl-5-propan-2-yl-1,3-dioxane |
|---|---|
| PubChem CID | 89076528 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 2-ethynyl-5-propan-2-yl-1,3-dioxane |
| SMILES | C#CC1OCC(C(C)C)CO1 |
| InChI | InChI=1S/C9H14O2/c1-4-9-10-5-8(6-11-9)7(2)3/h1,7-9H,5-6H2,2-3H3 |
| InChIKey | CJYYFXBTJGRPQJ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|