C11H22O2 — CID 89076519
2-butyl-5-propan-2-yl-1,3-dioxane (PubChem CID 89076519) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is 2-butyl-5-propan-2-yl-1,3-dioxane.
| Compound Name | 2-butyl-5-propan-2-yl-1,3-dioxane |
|---|---|
| PubChem CID | 89076519 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 2-butyl-5-propan-2-yl-1,3-dioxane |
| SMILES | CCCCC1OCC(C(C)C)CO1 |
| InChI | InChI=1S/C11H22O2/c1-4-5-6-11-12-7-10(8-13-11)9(2)3/h9-11H,4-8H2,1-3H3 |
| InChIKey | IMBTXOWABVKCIQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |