C8H16O3 — CID 174705925
2-butyl-4-methoxy-1,3-dioxolane (PubChem CID 174705925) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is 2-butyl-4-methoxy-1,3-dioxolane.
| Compound Name | 2-butyl-4-methoxy-1,3-dioxolane |
|---|---|
| PubChem CID | 174705925 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 2-butyl-4-methoxy-1,3-dioxolane |
| SMILES | CCCCC1OCC(OC)O1 |
| InChI | InChI=1S/C8H16O3/c1-3-4-5-7-10-6-8(9-2)11-7/h7-8H,3-6H2,1-2H3 |
| InChIKey | NETPEDURAJUUAV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |