About 2-butyl-4-methoxy-1,3-dioxolane
2-butyl-4-methoxy-1,3-dioxolane (PubChem CID 174705925) has the molecular formula C8H16O3
and a molecular weight of 160.21 g/mol. Its IUPAC name is 2-butyl-4-methoxy-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-butyl-4-methoxy-1,3-dioxolane |
| PubChem CID | 174705925 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 2-butyl-4-methoxy-1,3-dioxolane |
| SMILES | CCCCC1OCC(OC)O1 |
| InChI | InChI=1S/C8H16O3/c1-3-4-5-7-10-6-8(9-2)11-7/h7-8H,3-6H2,1-2H3 |
| InChIKey | NETPEDURAJUUAV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-butyl-4-methoxy-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-4-methoxy-1,3-dioxolane?
The IUPAC name of 2-butyl-4-methoxy-1,3-dioxolane (CID 174705925) is 2-butyl-4-methoxy-1,3-dioxolane.
What is the SMILES notation for 2-butyl-4-methoxy-1,3-dioxolane?
The canonical SMILES for 2-butyl-4-methoxy-1,3-dioxolane is CCCCC1OCC(OC)O1.
What is the InChIKey of 2-butyl-4-methoxy-1,3-dioxolane?
The InChIKey is NETPEDURAJUUAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O3/c1-3-4-5-7-10-6-8(9-2)11-7/h7-8H,3-6H2,1-2H3.
What are the key properties of 2-butyl-4-methoxy-1,3-dioxolane?
2-butyl-4-methoxy-1,3-dioxolane has a molecular weight of 160.21 g/mol, XLogP of 1.52, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-4-methoxy-1,3-dioxolane is sourced from PubChem (CID 174705925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).