C10H8O2 — CID 140617899
5-buta-1,3-diynyl-2-ethynyl-1,3-dioxane (PubChem CID 140617899) has the molecular formula C10H8O2 and a molecular weight of 160.17 g/mol. Its IUPAC name is 5-buta-1,3-diynyl-2-ethynyl-1,3-dioxane.
| Compound Name | 5-buta-1,3-diynyl-2-ethynyl-1,3-dioxane |
|---|---|
| PubChem CID | 140617899 |
| Molecular Formula | C10H8O2 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | 5-buta-1,3-diynyl-2-ethynyl-1,3-dioxane |
| SMILES | C#CC#CC1COC(C#C)OC1 |
| InChI | InChI=1S/C10H8O2/c1-3-5-6-9-7-11-10(4-2)12-8-9/h1-2,9-10H,7-8H2 |
| InChIKey | CBMAOGLGMCIAJM-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|