C11H18O — CID 174183967
2,6-diethyl-4-ethynyloxane (PubChem CID 174183967) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is 2,6-diethyl-4-ethynyloxane.
| Compound Name | 2,6-diethyl-4-ethynyloxane |
|---|---|
| PubChem CID | 174183967 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 2,6-diethyl-4-ethynyloxane |
| SMILES | C#CC1CC(CC)OC(CC)C1 |
| InChI | InChI=1S/C11H18O/c1-4-9-7-10(5-2)12-11(6-3)8-9/h1,9-11H,5-8H2,2-3H3 |
| InChIKey | XOXHZIKZMWBJHN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|