About 4,6-diethyloxan-2-ol
4,6-diethyloxan-2-ol (PubChem CID 90730118) has the molecular formula C9H18O2
and a molecular weight of 158.24 g/mol. Its IUPAC name is 4,6-diethyloxan-2-ol.
Molecular Properties
| Compound Name | 4,6-diethyloxan-2-ol |
| PubChem CID | 90730118 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | 4,6-diethyloxan-2-ol |
| SMILES | CCC1CC(O)OC(CC)C1 |
| InChI | InChI=1S/C9H18O2/c1-3-7-5-8(4-2)11-9(10)6-7/h7-10H,3-6H2,1-2H3 |
| InChIKey | FIYCQYCTAOHHJK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,6-diethyloxan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-diethyloxan-2-ol?
The IUPAC name of 4,6-diethyloxan-2-ol (CID 90730118) is 4,6-diethyloxan-2-ol.
What is the SMILES notation for 4,6-diethyloxan-2-ol?
The canonical SMILES for 4,6-diethyloxan-2-ol is CCC1CC(O)OC(CC)C1.
What is the InChIKey of 4,6-diethyloxan-2-ol?
The InChIKey is FIYCQYCTAOHHJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2/c1-3-7-5-8(4-2)11-9(10)6-7/h7-10H,3-6H2,1-2H3.
What are the key properties of 4,6-diethyloxan-2-ol?
4,6-diethyloxan-2-ol has a molecular weight of 158.24 g/mol, XLogP of 1.92, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-diethyloxan-2-ol is sourced from PubChem (CID 90730118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).