About propan-2-ylcyclohexane;4-propan-2-yloxane;3-propan-2-yloxetane
propan-2-ylcyclohexane;4-propan-2-yloxane;3-propan-2-yloxetane (PubChem CID 167674182) has the molecular formula C23H46O2
and a molecular weight of 354.62 g/mol. Its IUPAC name is propan-2-ylcyclohexane;4-propan-2-yloxane;3-propan-2-yloxetane.
Molecular Properties
| Compound Name | propan-2-ylcyclohexane;4-propan-2-yloxane;3-propan-2-yloxetane |
| PubChem CID | 167674182 |
| Molecular Formula | C23H46O2 |
| Molecular Weight | 354.62 g/mol |
| Exact Mass | 354.35 |
| IUPAC Name | propan-2-ylcyclohexane;4-propan-2-yloxane;3-propan-2-yloxetane |
| SMILES | CC(C)C1CCCCC1.CC(C)C1CCOCC1.CC(C)C1COC1 |
| InChI | InChI=1S/C9H18.C8H16O.C6H12O/c1-8(2)9-6-4-3-5-7-9;1-7(2)8-3-5-9-6-4-8;1-5(2)6-3-7-4-6/h8-9H,3-7H2,1-2H3;7-8H,3-6H2,1-2H3;5-6H,3-4H2,1-2H3 |
| InChIKey | UOOMCHWSLMDKHI-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.62 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propan-2-ylcyclohexane;4-propan-2-yloxane;3-propan-2-yloxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-ylcyclohexane;4-propan-2-yloxane;3-propan-2-yloxetane?
The IUPAC name of propan-2-ylcyclohexane;4-propan-2-yloxane;3-propan-2-yloxetane (CID 167674182) is propan-2-ylcyclohexane;4-propan-2-yloxane;3-propan-2-yloxetane.
What is the SMILES notation for propan-2-ylcyclohexane;4-propan-2-yloxane;3-propan-2-yloxetane?
The canonical SMILES for propan-2-ylcyclohexane;4-propan-2-yloxane;3-propan-2-yloxetane is CC(C)C1CCCCC1.CC(C)C1CCOCC1.CC(C)C1COC1.
What is the InChIKey of propan-2-ylcyclohexane;4-propan-2-yloxane;3-propan-2-yloxetane?
The InChIKey is UOOMCHWSLMDKHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18.C8H16O.C6H12O/c1-8(2)9-6-4-3-5-7-9;1-7(2)8-3-5-9-6-4-8;1-5(2)6-3-7-4-6/h8-9H,3-7H2,1-2H3;7-8H,3-6H2,1-2H3;5-6H,3-4H2,1-2H3.
What are the key properties of propan-2-ylcyclohexane;4-propan-2-yloxane;3-propan-2-yloxetane?
propan-2-ylcyclohexane;4-propan-2-yloxane;3-propan-2-yloxetane has a molecular weight of 354.62 g/mol, XLogP of 6.58, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-ylcyclohexane;4-propan-2-yloxane;3-propan-2-yloxetane is sourced from PubChem (CID 167674182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).