About ethane;4-propan-2-yloxane;4-propan-2-ylthiane
ethane;4-propan-2-yloxane;4-propan-2-ylthiane (PubChem CID 170972006) has the molecular formula C18H38OS
and a molecular weight of 302.57 g/mol. Its IUPAC name is ethane;4-propan-2-yloxane;4-propan-2-ylthiane.
Molecular Properties
| Compound Name | ethane;4-propan-2-yloxane;4-propan-2-ylthiane |
| PubChem CID | 170972006 |
| Molecular Formula | C18H38OS |
| Molecular Weight | 302.57 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | ethane;4-propan-2-yloxane;4-propan-2-ylthiane |
| SMILES | CC.CC(C)C1CCOCC1.CC(C)C1CCSCC1 |
| InChI | InChI=1S/C8H16O.C8H16S.C2H6/c2*1-7(2)8-3-5-9-6-4-8;1-2/h2*7-8H,3-6H2,1-2H3;1-2H3 |
| InChIKey | NONWLXDFNDCTQV-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.57 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4-propan-2-yloxane;4-propan-2-ylthiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-propan-2-yloxane;4-propan-2-ylthiane?
The IUPAC name of ethane;4-propan-2-yloxane;4-propan-2-ylthiane (CID 170972006) is ethane;4-propan-2-yloxane;4-propan-2-ylthiane.
What is the SMILES notation for ethane;4-propan-2-yloxane;4-propan-2-ylthiane?
The canonical SMILES for ethane;4-propan-2-yloxane;4-propan-2-ylthiane is CC.CC(C)C1CCOCC1.CC(C)C1CCSCC1.
What is the InChIKey of ethane;4-propan-2-yloxane;4-propan-2-ylthiane?
The InChIKey is NONWLXDFNDCTQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O.C8H16S.C2H6/c2*1-7(2)8-3-5-9-6-4-8;1-2/h2*7-8H,3-6H2,1-2H3;1-2H3.
What are the key properties of ethane;4-propan-2-yloxane;4-propan-2-ylthiane?
ethane;4-propan-2-yloxane;4-propan-2-ylthiane has a molecular weight of 302.57 g/mol, XLogP of 5.88, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-propan-2-yloxane;4-propan-2-ylthiane is sourced from PubChem (CID 170972006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).