About N,N-dimethyl-4-propan-2-ylcyclohexan-1-amine;4-propan-2-yloxane
N,N-dimethyl-4-propan-2-ylcyclohexan-1-amine;4-propan-2-yloxane (PubChem CID 158111671) has the molecular formula C19H39NO
and a molecular weight of 297.53 g/mol. Its IUPAC name is N,N-dimethyl-4-propan-2-ylcyclohexan-1-amine;4-propan-2-yloxane.
Molecular Properties
| Compound Name | N,N-dimethyl-4-propan-2-ylcyclohexan-1-amine;4-propan-2-yloxane |
| PubChem CID | 158111671 |
| Molecular Formula | C19H39NO |
| Molecular Weight | 297.53 g/mol |
| Exact Mass | 297.30 |
| IUPAC Name | N,N-dimethyl-4-propan-2-ylcyclohexan-1-amine;4-propan-2-yloxane |
| SMILES | CC(C)C1CCC(N(C)C)CC1.CC(C)C1CCOCC1 |
| InChI | InChI=1S/C11H23N.C8H16O/c1-9(2)10-5-7-11(8-6-10)12(3)4;1-7(2)8-3-5-9-6-4-8/h9-11H,5-8H2,1-4H3;7-8H,3-6H2,1-2H3 |
| InChIKey | FQMYZVSLZOOUPN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dimethyl-4-propan-2-ylcyclohexan-1-amine;4-propan-2-yloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-4-propan-2-ylcyclohexan-1-amine;4-propan-2-yloxane?
The IUPAC name of N,N-dimethyl-4-propan-2-ylcyclohexan-1-amine;4-propan-2-yloxane (CID 158111671) is N,N-dimethyl-4-propan-2-ylcyclohexan-1-amine;4-propan-2-yloxane.
What is the SMILES notation for N,N-dimethyl-4-propan-2-ylcyclohexan-1-amine;4-propan-2-yloxane?
The canonical SMILES for N,N-dimethyl-4-propan-2-ylcyclohexan-1-amine;4-propan-2-yloxane is CC(C)C1CCC(N(C)C)CC1.CC(C)C1CCOCC1.
What is the InChIKey of N,N-dimethyl-4-propan-2-ylcyclohexan-1-amine;4-propan-2-yloxane?
The InChIKey is FQMYZVSLZOOUPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N.C8H16O/c1-9(2)10-5-7-11(8-6-10)12(3)4;1-7(2)8-3-5-9-6-4-8/h9-11H,5-8H2,1-4H3;7-8H,3-6H2,1-2H3.
What are the key properties of N,N-dimethyl-4-propan-2-ylcyclohexan-1-amine;4-propan-2-yloxane?
N,N-dimethyl-4-propan-2-ylcyclohexan-1-amine;4-propan-2-yloxane has a molecular weight of 297.53 g/mol, XLogP of 4.83, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-4-propan-2-ylcyclohexan-1-amine;4-propan-2-yloxane is sourced from PubChem (CID 158111671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).