C11H22IN — CID 142071347
4-(1-iodopropyl)-N,N-dimethylcyclohexan-1-amine (PubChem CID 142071347) has the molecular formula C11H22IN and a molecular weight of 295.21 g/mol. Its IUPAC name is 4-(1-iodopropyl)-N,N-dimethylcyclohexan-1-amine.
| Compound Name | 4-(1-iodopropyl)-N,N-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 142071347 |
| Molecular Formula | C11H22IN |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 4-(1-iodopropyl)-N,N-dimethylcyclohexan-1-amine |
| SMILES | CCC(I)C1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C11H22IN/c1-4-11(12)9-5-7-10(8-6-9)13(2)3/h9-11H,4-8H2,1-3H3 |
| InChIKey | FGCHRXRSEUKFEX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|