C13H29N — CID 169113778
N,N-dimethyl-4-propan-2-ylcyclohexan-1-amine;ethane (PubChem CID 169113778) has the molecular formula C13H29N and a molecular weight of 199.38 g/mol. Its IUPAC name is N,N-dimethyl-4-propan-2-ylcyclohexan-1-amine;ethane.
| Compound Name | N,N-dimethyl-4-propan-2-ylcyclohexan-1-amine;ethane |
|---|---|
| PubChem CID | 169113778 |
| Molecular Formula | C13H29N |
| Molecular Weight | 199.38 g/mol |
| Exact Mass | 199.23 |
| IUPAC Name | N,N-dimethyl-4-propan-2-ylcyclohexan-1-amine;ethane |
| SMILES | CC.CC(C)C1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C11H23N.C2H6/c1-9(2)10-5-7-11(8-6-10)12(3)4;1-2/h9-11H,5-8H2,1-4H3;1-2H3 |
| InChIKey | JUBCDQPVUUENOQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |