About 4-(dimethylamino)cyclohexan-1-ol;vanadium
4-(dimethylamino)cyclohexan-1-ol;vanadium (PubChem CID 176696741) has the molecular formula C8H17NOV
and a molecular weight of 194.17 g/mol. Its IUPAC name is 4-(dimethylamino)cyclohexan-1-ol;vanadium.
Molecular Properties
| Compound Name | 4-(dimethylamino)cyclohexan-1-ol;vanadium |
| PubChem CID | 176696741 |
| Molecular Formula | C8H17NOV |
| Molecular Weight | 194.17 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 4-(dimethylamino)cyclohexan-1-ol;vanadium |
| SMILES | CN(C)C1CCC(O)CC1.[V] |
| InChI | InChI=1S/C8H17NO.V/c1-9(2)7-3-5-8(10)6-4-7;/h7-8,10H,3-6H2,1-2H3; |
| InChIKey | YFTDAOBNQFSSPK-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.17 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(dimethylamino)cyclohexan-1-ol;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)cyclohexan-1-ol;vanadium?
The IUPAC name of 4-(dimethylamino)cyclohexan-1-ol;vanadium (CID 176696741) is 4-(dimethylamino)cyclohexan-1-ol;vanadium.
What is the SMILES notation for 4-(dimethylamino)cyclohexan-1-ol;vanadium?
The canonical SMILES for 4-(dimethylamino)cyclohexan-1-ol;vanadium is CN(C)C1CCC(O)CC1.[V].
What is the InChIKey of 4-(dimethylamino)cyclohexan-1-ol;vanadium?
The InChIKey is YFTDAOBNQFSSPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO.V/c1-9(2)7-3-5-8(10)6-4-7;/h7-8,10H,3-6H2,1-2H3;.
What are the key properties of 4-(dimethylamino)cyclohexan-1-ol;vanadium?
4-(dimethylamino)cyclohexan-1-ol;vanadium has a molecular weight of 194.17 g/mol, XLogP of 0.85, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)cyclohexan-1-ol;vanadium is sourced from PubChem (CID 176696741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).